C26H25N3O4 — CID 158477926
formic acid;1-methyl-N-[(4S)-4-(4-methylphenyl)-2,3-dihydropyrano[3,2-b]pyridin-4-yl]indole-3-carboxamide (PubChem CID 158477926) has the molecular formula C26H25N3O4 and a molecular weight of 443.50 g/mol. Its IUPAC name is formic acid;1-methyl-N-[(4S)-4-(4-methylphenyl)-2,3-dihydropyrano[3,2-b]pyridin-4-yl]indole-3-carboxamide.
| Compound Name | formic acid;1-methyl-N-[(4S)-4-(4-methylphenyl)-2,3-dihydropyrano[3,2-b]pyridin-4-yl]indole-3-carboxamide |
|---|---|
| PubChem CID | 158477926 |
| Molecular Formula | C26H25N3O4 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | formic acid;1-methyl-N-[(4S)-4-(4-methylphenyl)-2,3-dihydropyrano[3,2-b]pyridin-4-yl]indole-3-carboxamide |
| SMILES | Cc1ccc([C@@]2(NC(=O)c3cn(C)c4ccccc34)CCOc3cccnc32)cc1.O=CO |
| InChI | InChI=1S/C25H23N3O2.CH2O2/c1-17-9-11-18(12-10-17)25(13-15-30-22-8-5-14-26-23(22)25)27-24(29)20-16-28(2)21-7-4-3-6-19(20)21;2-1-3/h3-12,14,16H,13,15H2,1-2H3,(H,27,29);1H,(H,2,3)/t25-;/m0./s1 |
| InChIKey | HHDXFUSKYZVAOH-UQIIZPHYSA-N |
| XLogP | 4.04 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|