About argon;N-ethyl-1-phenylpiperidine-3-carboxamide;methyl acetate
argon;N-ethyl-1-phenylpiperidine-3-carboxamide;methyl acetate (PubChem CID 158679002) has the molecular formula C17H26ArN2O3
and a molecular weight of 346.35 g/mol. Its IUPAC name is argon;N-ethyl-1-phenylpiperidine-3-carboxamide;methyl acetate.
Molecular Properties
| Compound Name | argon;N-ethyl-1-phenylpiperidine-3-carboxamide;methyl acetate |
| PubChem CID | 158679002 |
| Molecular Formula | C17H26ArN2O3 |
| Molecular Weight | 346.35 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | argon;N-ethyl-1-phenylpiperidine-3-carboxamide;methyl acetate |
| SMILES | CCNC(=O)C1CCCN(c2ccccc2)C1.COC(C)=O.[Ar] |
| InChI | InChI=1S/C14H20N2O.C3H6O2.Ar/c1-2-15-14(17)12-7-6-10-16(11-12)13-8-4-3-5-9-13;1-3(4)5-2;/h3-5,8-9,12H,2,6-7,10-11H2,1H3,(H,15,17);1-2H3; |
| InChIKey | IEWMYEBBIDLJSU-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.35 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze argon;N-ethyl-1-phenylpiperidine-3-carboxamide;methyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of argon;N-ethyl-1-phenylpiperidine-3-carboxamide;methyl acetate?
The IUPAC name of argon;N-ethyl-1-phenylpiperidine-3-carboxamide;methyl acetate (CID 158679002) is argon;N-ethyl-1-phenylpiperidine-3-carboxamide;methyl acetate.
What is the SMILES notation for argon;N-ethyl-1-phenylpiperidine-3-carboxamide;methyl acetate?
The canonical SMILES for argon;N-ethyl-1-phenylpiperidine-3-carboxamide;methyl acetate is CCNC(=O)C1CCCN(c2ccccc2)C1.COC(C)=O.[Ar].
What is the InChIKey of argon;N-ethyl-1-phenylpiperidine-3-carboxamide;methyl acetate?
The InChIKey is IEWMYEBBIDLJSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N2O.C3H6O2.Ar/c1-2-15-14(17)12-7-6-10-16(11-12)13-8-4-3-5-9-13;1-3(4)5-2;/h3-5,8-9,12H,2,6-7,10-11H2,1H3,(H,15,17);1-2H3;.
What are the key properties of argon;N-ethyl-1-phenylpiperidine-3-carboxamide;methyl acetate?
argon;N-ethyl-1-phenylpiperidine-3-carboxamide;methyl acetate has a molecular weight of 346.35 g/mol, XLogP of 2.22, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for argon;N-ethyl-1-phenylpiperidine-3-carboxamide;methyl acetate is sourced from PubChem (CID 158679002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).