C17H26ArN2O3 — CID 158679002
argon;N-ethyl-1-phenylpiperidine-3-carboxamide;methyl acetate (PubChem CID 158679002) has the molecular formula C17H26ArN2O3 and a molecular weight of 346.35 g/mol. Its IUPAC name is argon;N-ethyl-1-phenylpiperidine-3-carboxamide;methyl acetate.
| Compound Name | argon;N-ethyl-1-phenylpiperidine-3-carboxamide;methyl acetate |
|---|---|
| PubChem CID | 158679002 |
| Molecular Formula | C17H26ArN2O3 |
| Molecular Weight | 346.35 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | argon;N-ethyl-1-phenylpiperidine-3-carboxamide;methyl acetate |
| SMILES | CCNC(=O)C1CCCN(c2ccccc2)C1.COC(C)=O.[Ar] |
| InChI | InChI=1S/C14H20N2O.C3H6O2.Ar/c1-2-15-14(17)12-7-6-10-16(11-12)13-8-4-3-5-9-13;1-3(4)5-2;/h3-5,8-9,12H,2,6-7,10-11H2,1H3,(H,15,17);1-2H3; |
| InChIKey | IEWMYEBBIDLJSU-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.35 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |