C33H47B2ClN4O4 — CID 158684286
1-[[2-(4-chlorophenyl)-4,4-dimethylcyclohexen-1-yl]methyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole (PubChem CID 158684286) has the molecular formula C33H47B2ClN4O4 and a molecular weight of 620.84 g/mol. Its IUPAC name is 1-[[2-(4-chlorophenyl)-4,4-dimethylcyclohexen-1-yl]methyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole.
| Compound Name | 1-[[2-(4-chlorophenyl)-4,4-dimethylcyclohexen-1-yl]methyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole |
|---|---|
| PubChem CID | 158684286 |
| Molecular Formula | C33H47B2ClN4O4 |
| Molecular Weight | 620.84 g/mol |
| Exact Mass | 620.35 |
| IUPAC Name | 1-[[2-(4-chlorophenyl)-4,4-dimethylcyclohexen-1-yl]methyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole |
| SMILES | CC1(C)CCC(Cn2cc(B3OC(C)(C)C(C)(C)O3)cn2)=C(c2ccc(Cl)cc2)C1.CC1(C)OB(c2cn[nH]c2)OC1(C)C |
| InChI | InChI=1S/C24H32BClN2O2.C9H15BN2O2/c1-22(2)12-11-18(21(13-22)17-7-9-20(26)10-8-17)15-28-16-19(14-27-28)25-29-23(3,4)24(5,6)30-25;1-8(2)9(3,4)14-10(13-8)7-5-11-12-6-7/h7-10,14,16H,11-13,15H2,1-6H3;5-6H,1-4H3,(H,11,12) |
| InChIKey | IFNMTSCMCSYTIY-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 83.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.84 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|