C24H32BClN2O2 — CID 89498342
1-[[2-(4-chlorophenyl)-4,4-dimethylcyclohexen-1-yl]methyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole (PubChem CID 89498342) has the molecular formula C24H32BClN2O2 and a molecular weight of 426.80 g/mol. Its IUPAC name is 1-[[2-(4-chlorophenyl)-4,4-dimethylcyclohexen-1-yl]methyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole.
| Compound Name | 1-[[2-(4-chlorophenyl)-4,4-dimethylcyclohexen-1-yl]methyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
|---|---|
| PubChem CID | 89498342 |
| Molecular Formula | C24H32BClN2O2 |
| Molecular Weight | 426.80 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | 1-[[2-(4-chlorophenyl)-4,4-dimethylcyclohexen-1-yl]methyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
| SMILES | CC1(C)CCC(Cn2cc(B3OC(C)(C)C(C)(C)O3)cn2)=C(c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C24H32BClN2O2/c1-22(2)12-11-18(21(13-22)17-7-9-20(26)10-8-17)15-28-16-19(14-27-28)25-29-23(3,4)24(5,6)30-25/h7-10,14,16H,11-13,15H2,1-6H3 |
| InChIKey | ABHVAYMNLJQIKW-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.80 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|