C32H44B2ClN3O4 — CID 158046536
4-(4-chlorophenyl)-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperidine;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole (PubChem CID 158046536) has the molecular formula C32H44B2ClN3O4 and a molecular weight of 591.80 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperidine;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole.
| Compound Name | 4-(4-chlorophenyl)-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperidine;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole |
|---|---|
| PubChem CID | 158046536 |
| Molecular Formula | C32H44B2ClN3O4 |
| Molecular Weight | 591.80 g/mol |
| Exact Mass | 591.32 |
| IUPAC Name | 4-(4-chlorophenyl)-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperidine;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole |
| SMILES | CC1(C)OB(c2ccc(C3(c4ccc(Cl)cc4)CCNCC3)cc2)OC1(C)C.CC1(C)OB(c2cn[nH]c2)OC1(C)C |
| InChI | InChI=1S/C23H29BClNO2.C9H15BN2O2/c1-21(2)22(3,4)28-24(27-21)19-9-5-17(6-10-19)23(13-15-26-16-14-23)18-7-11-20(25)12-8-18;1-8(2)9(3,4)14-10(13-8)7-5-11-12-6-7/h5-12,26H,13-16H2,1-4H3;5-6H,1-4H3,(H,11,12) |
| InChIKey | FIZCVVDWIKMLFZ-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 77.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.80 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|