C16H32BN3O2 — CID 171847392
ethane;piperidine;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole (PubChem CID 171847392) has the molecular formula C16H32BN3O2 and a molecular weight of 309.26 g/mol. Its IUPAC name is ethane;piperidine;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole.
| Compound Name | ethane;piperidine;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole |
|---|---|
| PubChem CID | 171847392 |
| Molecular Formula | C16H32BN3O2 |
| Molecular Weight | 309.26 g/mol |
| Exact Mass | 309.26 |
| IUPAC Name | ethane;piperidine;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole |
| SMILES | C1CCNCC1.CC.CC1(C)OB(c2cn[nH]c2)OC1(C)C |
| InChI | InChI=1S/C9H15BN2O2.C5H11N.C2H6/c1-8(2)9(3,4)14-10(13-8)7-5-11-12-6-7;1-2-4-6-5-3-1;1-2/h5-6H,1-4H3,(H,11,12);6H,1-5H2;1-2H3 |
| InChIKey | RBAAKYNMTRGPHJ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 59.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.26 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|