C17H31BN2O3 — CID 162725536
2-cyclohexylethanol;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole (PubChem CID 162725536) has the molecular formula C17H31BN2O3 and a molecular weight of 322.26 g/mol. Its IUPAC name is 2-cyclohexylethanol;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole.
| Compound Name | 2-cyclohexylethanol;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole |
|---|---|
| PubChem CID | 162725536 |
| Molecular Formula | C17H31BN2O3 |
| Molecular Weight | 322.26 g/mol |
| Exact Mass | 322.24 |
| IUPAC Name | 2-cyclohexylethanol;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole |
| SMILES | CC1(C)OB(c2cn[nH]c2)OC1(C)C.OCCC1CCCCC1 |
| InChI | InChI=1S/C9H15BN2O2.C8H16O/c1-8(2)9(3,4)14-10(13-8)7-5-11-12-6-7;9-7-6-8-4-2-1-3-5-8/h5-6H,1-4H3,(H,11,12);8-9H,1-7H2 |
| InChIKey | WIFLVGCCZPLQKD-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 67.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.26 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|