About methyl 4-(3,4-dimethyl-1,2-thiazol-5-yl)-4-oxobutanoate
methyl 4-(3,4-dimethyl-1,2-thiazol-5-yl)-4-oxobutanoate (PubChem CID 158686401) has the molecular formula C10H13NO3S
and a molecular weight of 227.28 g/mol. Its IUPAC name is methyl 4-(3,4-dimethyl-1,2-thiazol-5-yl)-4-oxobutanoate.
Analyze methyl 4-(3,4-dimethyl-1,2-thiazol-5-yl)-4-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-(3,4-dimethyl-1,2-thiazol-5-yl)-4-oxobutanoate?
The IUPAC name of methyl 4-(3,4-dimethyl-1,2-thiazol-5-yl)-4-oxobutanoate (CID 158686401) is methyl 4-(3,4-dimethyl-1,2-thiazol-5-yl)-4-oxobutanoate.
What is the SMILES notation for methyl 4-(3,4-dimethyl-1,2-thiazol-5-yl)-4-oxobutanoate?
The canonical SMILES for methyl 4-(3,4-dimethyl-1,2-thiazol-5-yl)-4-oxobutanoate is COC(=O)CCC(=O)c1snc(C)c1C.
What is the InChIKey of methyl 4-(3,4-dimethyl-1,2-thiazol-5-yl)-4-oxobutanoate?
The InChIKey is IFUHYLITMATISB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO3S/c1-6-7(2)11-15-10(6)8(12)4-5-9(13)14-3/h4-5H2,1-3H3.
What are the key properties of methyl 4-(3,4-dimethyl-1,2-thiazol-5-yl)-4-oxobutanoate?
methyl 4-(3,4-dimethyl-1,2-thiazol-5-yl)-4-oxobutanoate has a molecular weight of 227.28 g/mol, XLogP of 1.90, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(3,4-dimethyl-1,2-thiazol-5-yl)-4-oxobutanoate is sourced from PubChem (CID 158686401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).