C41H50N8O7 — CID 158687303
1-ethylpiperidine;4-(3-methoxyphenyl)-N-methyl-N-piperidin-1-ylimidazole-1-carboxamide;(4-nitrophenyl) 4-(3-methoxyphenyl)imidazole-1-carboxylate (PubChem CID 158687303) has the molecular formula C41H50N8O7 and a molecular weight of 766.90 g/mol. Its IUPAC name is 1-ethylpiperidine;4-(3-methoxyphenyl)-N-methyl-N-piperidin-1-ylimidazole-1-carboxamide;(4-nitrophenyl) 4-(3-methoxyphenyl)imidazole-1-carboxylate.
| Compound Name | 1-ethylpiperidine;4-(3-methoxyphenyl)-N-methyl-N-piperidin-1-ylimidazole-1-carboxamide;(4-nitrophenyl) 4-(3-methoxyphenyl)imidazole-1-carboxylate |
|---|---|
| PubChem CID | 158687303 |
| Molecular Formula | C41H50N8O7 |
| Molecular Weight | 766.90 g/mol |
| Exact Mass | 766.38 |
| IUPAC Name | 1-ethylpiperidine;4-(3-methoxyphenyl)-N-methyl-N-piperidin-1-ylimidazole-1-carboxamide;(4-nitrophenyl) 4-(3-methoxyphenyl)imidazole-1-carboxylate |
| SMILES | CCN1CCCCC1.COc1cccc(-c2cn(C(=O)N(C)N3CCCCC3)cn2)c1.COc1cccc(-c2cn(C(=O)Oc3ccc([N+](=O)[O-])cc3)cn2)c1 |
| InChI | InChI=1S/C17H22N4O2.C17H13N3O5.C7H15N/c1-19(21-9-4-3-5-10-21)17(22)20-12-16(18-13-20)14-7-6-8-15(11-14)23-2;1-24-15-4-2-3-12(9-15)16-10-19(11-18-16)17(21)25-14-7-5-13(6-8-14)20(22)23;1-2-8-6-4-3-5-7-8/h6-8,11-13H,3-5,9-10H2,1-2H3;2-11H,1H3;2-7H2,1H3 |
| InChIKey | YJTSDDNQWWLANM-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 150.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.90 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|