C41H50N8O9S2 — CID 157118653
1-ethylpiperidine;N-methyl-4-(4-methylsulfonylphenyl)-N-piperidin-1-ylimidazole-1-carboxamide;(4-nitrophenyl) 4-(4-methylsulfonylphenyl)imidazole-1-carboxylate (PubChem CID 157118653) has the molecular formula C41H50N8O9S2 and a molecular weight of 863.03 g/mol. Its IUPAC name is 1-ethylpiperidine;N-methyl-4-(4-methylsulfonylphenyl)-N-piperidin-1-ylimidazole-1-carboxamide;(4-nitrophenyl) 4-(4-methylsulfonylphenyl)imidazole-1-carboxylate.
| Compound Name | 1-ethylpiperidine;N-methyl-4-(4-methylsulfonylphenyl)-N-piperidin-1-ylimidazole-1-carboxamide;(4-nitrophenyl) 4-(4-methylsulfonylphenyl)imidazole-1-carboxylate |
|---|---|
| PubChem CID | 157118653 |
| Molecular Formula | C41H50N8O9S2 |
| Molecular Weight | 863.03 g/mol |
| Exact Mass | 862.31 |
| IUPAC Name | 1-ethylpiperidine;N-methyl-4-(4-methylsulfonylphenyl)-N-piperidin-1-ylimidazole-1-carboxamide;(4-nitrophenyl) 4-(4-methylsulfonylphenyl)imidazole-1-carboxylate |
| SMILES | CCN1CCCCC1.CN(C(=O)n1cnc(-c2ccc(S(C)(=O)=O)cc2)c1)N1CCCCC1.CS(=O)(=O)c1ccc(-c2cn(C(=O)Oc3ccc([N+](=O)[O-])cc3)cn2)cc1 |
| InChI | InChI=1S/C17H22N4O3S.C17H13N3O6S.C7H15N/c1-19(21-10-4-3-5-11-21)17(22)20-12-16(18-13-20)14-6-8-15(9-7-14)25(2,23)24;1-27(24,25)15-8-2-12(3-9-15)16-10-19(11-18-16)17(21)26-14-6-4-13(5-7-14)20(22)23;1-2-8-6-4-3-5-7-8/h6-9,12-13H,3-5,10-11H2,1-2H3;2-11H,1H3;2-7H2,1H3 |
| InChIKey | AHRTYTUJMKZFPL-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 200.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 863.03 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|