C39H46N8O9 — CID 158760378
4-ethylmorpholine;4-(3-methoxyphenyl)-N-methyl-N-morpholin-4-ylimidazole-1-carboxamide;(4-nitrophenyl) 4-(3-methoxyphenyl)imidazole-1-carboxylate (PubChem CID 158760378) has the molecular formula C39H46N8O9 and a molecular weight of 770.84 g/mol. Its IUPAC name is 4-ethylmorpholine;4-(3-methoxyphenyl)-N-methyl-N-morpholin-4-ylimidazole-1-carboxamide;(4-nitrophenyl) 4-(3-methoxyphenyl)imidazole-1-carboxylate.
| Compound Name | 4-ethylmorpholine;4-(3-methoxyphenyl)-N-methyl-N-morpholin-4-ylimidazole-1-carboxamide;(4-nitrophenyl) 4-(3-methoxyphenyl)imidazole-1-carboxylate |
|---|---|
| PubChem CID | 158760378 |
| Molecular Formula | C39H46N8O9 |
| Molecular Weight | 770.84 g/mol |
| Exact Mass | 770.34 |
| IUPAC Name | 4-ethylmorpholine;4-(3-methoxyphenyl)-N-methyl-N-morpholin-4-ylimidazole-1-carboxamide;(4-nitrophenyl) 4-(3-methoxyphenyl)imidazole-1-carboxylate |
| SMILES | CCN1CCOCC1.COc1cccc(-c2cn(C(=O)N(C)N3CCOCC3)cn2)c1.COc1cccc(-c2cn(C(=O)Oc3ccc([N+](=O)[O-])cc3)cn2)c1 |
| InChI | InChI=1S/C17H13N3O5.C16H20N4O3.C6H13NO/c1-24-15-4-2-3-12(9-15)16-10-19(11-18-16)17(21)25-14-7-5-13(6-8-14)20(22)23;1-18(20-6-8-23-9-7-20)16(21)19-11-15(17-12-19)13-4-3-5-14(10-13)22-2;1-2-7-3-5-8-6-4-7/h2-11H,1H3;3-5,10-12H,6-9H2,1-2H3;2-6H2,1H3 |
| InChIKey | YRAPCZIGYYVLJI-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 168.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.84 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|