C17H32N2O9 — CID 158696484
butyl N-(1,3-dihydroxypropan-2-yl)carbamate;butyl N-(2-oxo-1,3-dioxan-5-yl)carbamate (PubChem CID 158696484) has the molecular formula C17H32N2O9 and a molecular weight of 408.45 g/mol. Its IUPAC name is butyl N-(1,3-dihydroxypropan-2-yl)carbamate;butyl N-(2-oxo-1,3-dioxan-5-yl)carbamate.
| Compound Name | butyl N-(1,3-dihydroxypropan-2-yl)carbamate;butyl N-(2-oxo-1,3-dioxan-5-yl)carbamate |
|---|---|
| PubChem CID | 158696484 |
| Molecular Formula | C17H32N2O9 |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.21 |
| IUPAC Name | butyl N-(1,3-dihydroxypropan-2-yl)carbamate;butyl N-(2-oxo-1,3-dioxan-5-yl)carbamate |
| SMILES | CCCCOC(=O)NC(CO)CO.CCCCOC(=O)NC1COC(=O)OC1 |
| InChI | InChI=1S/C9H15NO5.C8H17NO4/c1-2-3-4-13-8(11)10-7-5-14-9(12)15-6-7;1-2-3-4-13-8(12)9-7(5-10)6-11/h7H,2-6H2,1H3,(H,10,11);7,10-11H,2-6H2,1H3,(H,9,12) |
| InChIKey | IGZXIODYXPOUDH-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 152.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|