C21H17FN4O4S — CID 15869675
(E)-1-(5,6-dihydro-1,4,2-oxathiazin-3-yl)-1-[2-(5-fluoro-6-phenoxypyrimidin-4-yl)oxyphenyl]-N-methoxymethanimine (PubChem CID 15869675) has the molecular formula C21H17FN4O4S and a molecular weight of 440.46 g/mol. Its IUPAC name is (E)-1-(5,6-dihydro-1,4,2-oxathiazin-3-yl)-1-[2-(5-fluoro-6-phenoxypyrimidin-4-yl)oxyphenyl]-N-methoxymethanimine.
| Compound Name | (E)-1-(5,6-dihydro-1,4,2-oxathiazin-3-yl)-1-[2-(5-fluoro-6-phenoxypyrimidin-4-yl)oxyphenyl]-N-methoxymethanimine |
|---|---|
| PubChem CID | 15869675 |
| Molecular Formula | C21H17FN4O4S |
| Molecular Weight | 440.46 g/mol |
| Exact Mass | 440.10 |
| IUPAC Name | (E)-1-(5,6-dihydro-1,4,2-oxathiazin-3-yl)-1-[2-(5-fluoro-6-phenoxypyrimidin-4-yl)oxyphenyl]-N-methoxymethanimine |
| SMILES | CO/N=C(/C1=NOCCS1)c1ccccc1Oc1ncnc(Oc2ccccc2)c1F |
| InChI | InChI=1S/C21H17FN4O4S/c1-27-25-18(21-26-28-11-12-31-21)15-9-5-6-10-16(15)30-20-17(22)19(23-13-24-20)29-14-7-3-2-4-8-14/h2-10,13H,11-12H2,1H3/b25-18+ |
| InChIKey | SGLVVSSFUKMMNW-XIEYBQDHSA-N |
| XLogP | 4.63 |
| TPSA | 87.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.46 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|