About 2-(2,2-difluoroethoxy)propane;2-(2-fluoroethoxy)propane;2-(2-fluoro-2-methoxyethoxy)propane
2-(2,2-difluoroethoxy)propane;2-(2-fluoroethoxy)propane;2-(2-fluoro-2-methoxyethoxy)propane (PubChem CID 158702191) has the molecular formula C16H34F4O4
and a molecular weight of 366.44 g/mol. Its IUPAC name is 2-(2,2-difluoroethoxy)propane;2-(2-fluoroethoxy)propane;2-(2-fluoro-2-methoxyethoxy)propane.
Molecular Properties
| Compound Name | 2-(2,2-difluoroethoxy)propane;2-(2-fluoroethoxy)propane;2-(2-fluoro-2-methoxyethoxy)propane |
| PubChem CID | 158702191 |
| Molecular Formula | C16H34F4O4 |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.24 |
| IUPAC Name | 2-(2,2-difluoroethoxy)propane;2-(2-fluoroethoxy)propane;2-(2-fluoro-2-methoxyethoxy)propane |
| SMILES | CC(C)OCC(F)F.CC(C)OCCF.COC(F)COC(C)C |
| InChI | InChI=1S/C6H13FO2.C5H10F2O.C5H11FO/c1-5(2)9-4-6(7)8-3;1-4(2)8-3-5(6)7;1-5(2)7-4-3-6/h5-6H,4H2,1-3H3;4-5H,3H2,1-2H3;5H,3-4H2,1-2H3 |
| InChIKey | IHRHOVFCWAQXCN-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(2,2-difluoroethoxy)propane;2-(2-fluoroethoxy)propane;2-(2-fluoro-2-methoxyethoxy)propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,2-difluoroethoxy)propane;2-(2-fluoroethoxy)propane;2-(2-fluoro-2-methoxyethoxy)propane?
The IUPAC name of 2-(2,2-difluoroethoxy)propane;2-(2-fluoroethoxy)propane;2-(2-fluoro-2-methoxyethoxy)propane (CID 158702191) is 2-(2,2-difluoroethoxy)propane;2-(2-fluoroethoxy)propane;2-(2-fluoro-2-methoxyethoxy)propane.
What is the SMILES notation for 2-(2,2-difluoroethoxy)propane;2-(2-fluoroethoxy)propane;2-(2-fluoro-2-methoxyethoxy)propane?
The canonical SMILES for 2-(2,2-difluoroethoxy)propane;2-(2-fluoroethoxy)propane;2-(2-fluoro-2-methoxyethoxy)propane is CC(C)OCC(F)F.CC(C)OCCF.COC(F)COC(C)C.
What is the InChIKey of 2-(2,2-difluoroethoxy)propane;2-(2-fluoroethoxy)propane;2-(2-fluoro-2-methoxyethoxy)propane?
The InChIKey is IHRHOVFCWAQXCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13FO2.C5H10F2O.C5H11FO/c1-5(2)9-4-6(7)8-3;1-4(2)8-3-5(6)7;1-5(2)7-4-3-6/h5-6H,4H2,1-3H3;4-5H,3H2,1-2H3;5H,3-4H2,1-2H3.
What are the key properties of 2-(2,2-difluoroethoxy)propane;2-(2-fluoroethoxy)propane;2-(2-fluoro-2-methoxyethoxy)propane?
2-(2,2-difluoroethoxy)propane;2-(2-fluoroethoxy)propane;2-(2-fluoro-2-methoxyethoxy)propane has a molecular weight of 366.44 g/mol, XLogP of 4.41, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2-difluoroethoxy)propane;2-(2-fluoroethoxy)propane;2-(2-fluoro-2-methoxyethoxy)propane is sourced from PubChem (CID 158702191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).