C24H28F3N5O5 — CID 15870968
methyl 3-[4-[[3-(diaminomethylideneamino)-5-(trifluoromethyl)benzoyl]amino]phenyl]-2-(2-methylpropoxycarbonylamino)propanoate (PubChem CID 15870968) has the molecular formula C24H28F3N5O5 and a molecular weight of 523.51 g/mol. Its IUPAC name is methyl 3-[4-[[3-(diaminomethylideneamino)-5-(trifluoromethyl)benzoyl]amino]phenyl]-2-(2-methylpropoxycarbonylamino)propanoate.
| Compound Name | methyl 3-[4-[[3-(diaminomethylideneamino)-5-(trifluoromethyl)benzoyl]amino]phenyl]-2-(2-methylpropoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 15870968 |
| Molecular Formula | C24H28F3N5O5 |
| Molecular Weight | 523.51 g/mol |
| Exact Mass | 523.20 |
| IUPAC Name | methyl 3-[4-[[3-(diaminomethylideneamino)-5-(trifluoromethyl)benzoyl]amino]phenyl]-2-(2-methylpropoxycarbonylamino)propanoate |
| SMILES | COC(=O)C(Cc1ccc(NC(=O)c2cc(N=C(N)N)cc(C(F)(F)F)c2)cc1)NC(=O)OCC(C)C |
| InChI | InChI=1S/C24H28F3N5O5/c1-13(2)12-37-23(35)32-19(21(34)36-3)8-14-4-6-17(7-5-14)30-20(33)15-9-16(24(25,26)27)11-18(10-15)31-22(28)29/h4-7,9-11,13,19H,8,12H2,1-3H3,(H,30,33)(H,32,35)(H4,28,29,31) |
| InChIKey | XVEKABPPHQAHPD-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 158.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.51 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|