C25H40F10O11 — CID 158711235
4-(3-but-3-enoxy-2-hydroxypropoxy)-1-[3,3,3-trifluoro-2-[1,1,1-trifluoro-3-[1,1,1,2-tetrafluoro-3-[2-hydroxy-3-(2-hydroxyethoxy)propoxy]propan-2-yl]oxypropan-2-yl]oxypropoxy]butan-2-ol (PubChem CID 158711235) has the molecular formula C25H40F10O11 and a molecular weight of 706.56 g/mol. Its IUPAC name is 4-(3-but-3-enoxy-2-hydroxypropoxy)-1-[3,3,3-trifluoro-2-[1,1,1-trifluoro-3-[1,1,1,2-tetrafluoro-3-[2-hydroxy-3-(2-hydroxyethoxy)propoxy]propan-2-yl]oxypropan-2-yl]oxypropoxy]butan-2-ol.
| Compound Name | 4-(3-but-3-enoxy-2-hydroxypropoxy)-1-[3,3,3-trifluoro-2-[1,1,1-trifluoro-3-[1,1,1,2-tetrafluoro-3-[2-hydroxy-3-(2-hydroxyethoxy)propoxy]propan-2-yl]oxypropan-2-yl]oxypropoxy]butan-2-ol |
|---|---|
| PubChem CID | 158711235 |
| Molecular Formula | C25H40F10O11 |
| Molecular Weight | 706.56 g/mol |
| Exact Mass | 706.24 |
| IUPAC Name | 4-(3-but-3-enoxy-2-hydroxypropoxy)-1-[3,3,3-trifluoro-2-[1,1,1-trifluoro-3-[1,1,1,2-tetrafluoro-3-[2-hydroxy-3-(2-hydroxyethoxy)propoxy]propan-2-yl]oxypropan-2-yl]oxypropoxy]butan-2-ol |
| SMILES | C=CCCOCC(O)COCCC(O)COCC(OC(COC(F)(COCC(O)COCCO)C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C25H40F10O11/c1-2-3-6-40-10-18(38)11-41-7-4-17(37)9-43-14-20(23(27,28)29)46-21(24(30,31)32)15-45-22(26,25(33,34)35)16-44-13-19(39)12-42-8-5-36/h2,17-21,36-39H,1,3-16H2 |
| InChIKey | IITAQBQUGZWTKP-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 145.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.56 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|