C24H42F6O12 — CID 165072350
5-but-3-enoxy-1-[3-[2-[2-[[1,1-difluoro-2-[2-hydroxy-3-(2-hydroxyethoxy)propoxy]ethoxy]-difluoromethoxy]-2,2-difluoroethoxy]ethoxy]-2-hydroxypropoxy]pentan-2-ol (PubChem CID 165072350) has the molecular formula C24H42F6O12 and a molecular weight of 636.58 g/mol. Its IUPAC name is 5-but-3-enoxy-1-[3-[2-[2-[[1,1-difluoro-2-[2-hydroxy-3-(2-hydroxyethoxy)propoxy]ethoxy]-difluoromethoxy]-2,2-difluoroethoxy]ethoxy]-2-hydroxypropoxy]pentan-2-ol.
| Compound Name | 5-but-3-enoxy-1-[3-[2-[2-[[1,1-difluoro-2-[2-hydroxy-3-(2-hydroxyethoxy)propoxy]ethoxy]-difluoromethoxy]-2,2-difluoroethoxy]ethoxy]-2-hydroxypropoxy]pentan-2-ol |
|---|---|
| PubChem CID | 165072350 |
| Molecular Formula | C24H42F6O12 |
| Molecular Weight | 636.58 g/mol |
| Exact Mass | 636.26 |
| IUPAC Name | 5-but-3-enoxy-1-[3-[2-[2-[[1,1-difluoro-2-[2-hydroxy-3-(2-hydroxyethoxy)propoxy]ethoxy]-difluoromethoxy]-2,2-difluoroethoxy]ethoxy]-2-hydroxypropoxy]pentan-2-ol |
| SMILES | C=CCCOCCCC(O)COCC(O)COCCOCC(F)(F)OC(F)(F)OC(F)(F)COCC(O)COCCO |
| InChI | InChI=1S/C24H42F6O12/c1-2-3-7-35-8-4-5-19(32)12-39-15-20(33)14-37-10-11-38-17-22(25,26)41-24(29,30)42-23(27,28)18-40-16-21(34)13-36-9-6-31/h2,19-21,31-34H,1,3-18H2 |
| InChIKey | SZBUZWXMCQVSFI-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 154.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.58 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|