C29H52F4O13 — CID 161383195
4-(3-but-3-enoxy-2-hydroxypropoxy)-1-[2-[[2-[2-[4-(3-but-3-enoxy-2-hydroxypropoxy)-2-hydroxybutoxy]-1,1-difluoroethoxy]-2,2-difluoroethoxy]methoxy]ethoxy]butan-2-ol (PubChem CID 161383195) has the molecular formula C29H52F4O13 and a molecular weight of 684.71 g/mol. Its IUPAC name is 4-(3-but-3-enoxy-2-hydroxypropoxy)-1-[2-[[2-[2-[4-(3-but-3-enoxy-2-hydroxypropoxy)-2-hydroxybutoxy]-1,1-difluoroethoxy]-2,2-difluoroethoxy]methoxy]ethoxy]butan-2-ol.
| Compound Name | 4-(3-but-3-enoxy-2-hydroxypropoxy)-1-[2-[[2-[2-[4-(3-but-3-enoxy-2-hydroxypropoxy)-2-hydroxybutoxy]-1,1-difluoroethoxy]-2,2-difluoroethoxy]methoxy]ethoxy]butan-2-ol |
|---|---|
| PubChem CID | 161383195 |
| Molecular Formula | C29H52F4O13 |
| Molecular Weight | 684.71 g/mol |
| Exact Mass | 684.33 |
| IUPAC Name | 4-(3-but-3-enoxy-2-hydroxypropoxy)-1-[2-[[2-[2-[4-(3-but-3-enoxy-2-hydroxypropoxy)-2-hydroxybutoxy]-1,1-difluoroethoxy]-2,2-difluoroethoxy]methoxy]ethoxy]butan-2-ol |
| SMILES | C=CCCOCC(O)COCCC(O)COCCOCOCC(F)(F)OC(F)(F)COCC(O)CCOCC(O)COCCC=C |
| InChI | InChI=1S/C29H52F4O13/c1-3-5-9-38-17-26(36)19-40-11-7-24(34)15-42-13-14-43-23-45-22-29(32,33)46-28(30,31)21-44-16-25(35)8-12-41-20-27(37)18-39-10-6-4-2/h3-4,24-27,34-37H,1-2,5-23H2 |
| InChIKey | VRZJYAGBYPCBCK-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 163.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.71 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|