C20H36F4O10 — CID 161221348
1-[2-[[2-[1,1-difluoro-2-(2-hydroxy-4-prop-2-enoxybutoxy)ethoxy]-2,2-difluoroethoxy]methoxy]ethoxy]-4-(2-hydroxyethoxy)butan-2-ol (PubChem CID 161221348) has the molecular formula C20H36F4O10 and a molecular weight of 512.49 g/mol. Its IUPAC name is 1-[2-[[2-[1,1-difluoro-2-(2-hydroxy-4-prop-2-enoxybutoxy)ethoxy]-2,2-difluoroethoxy]methoxy]ethoxy]-4-(2-hydroxyethoxy)butan-2-ol.
| Compound Name | 1-[2-[[2-[1,1-difluoro-2-(2-hydroxy-4-prop-2-enoxybutoxy)ethoxy]-2,2-difluoroethoxy]methoxy]ethoxy]-4-(2-hydroxyethoxy)butan-2-ol |
|---|---|
| PubChem CID | 161221348 |
| Molecular Formula | C20H36F4O10 |
| Molecular Weight | 512.49 g/mol |
| Exact Mass | 512.22 |
| IUPAC Name | 1-[2-[[2-[1,1-difluoro-2-(2-hydroxy-4-prop-2-enoxybutoxy)ethoxy]-2,2-difluoroethoxy]methoxy]ethoxy]-4-(2-hydroxyethoxy)butan-2-ol |
| SMILES | C=CCOCCC(O)COCC(F)(F)OC(F)(F)COCOCCOCC(O)CCOCCO |
| InChI | InChI=1S/C20H36F4O10/c1-2-6-28-7-3-18(27)13-32-14-19(21,22)34-20(23,24)15-33-16-31-11-10-30-12-17(26)4-8-29-9-5-25/h2,17-18,25-27H,1,3-16H2 |
| InChIKey | UXOABPRIGVOALZ-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 125.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.49 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|