C16H28F4O9 — CID 157084760
1-[3-[2-[1,1-difluoro-2-(2-hydroxyethoxymethoxy)ethoxy]-2,2-difluoroethoxy]-2-hydroxypropoxy]-3-prop-2-enoxypropan-2-ol (PubChem CID 157084760) has the molecular formula C16H28F4O9 and a molecular weight of 440.38 g/mol. Its IUPAC name is 1-[3-[2-[1,1-difluoro-2-(2-hydroxyethoxymethoxy)ethoxy]-2,2-difluoroethoxy]-2-hydroxypropoxy]-3-prop-2-enoxypropan-2-ol.
| Compound Name | 1-[3-[2-[1,1-difluoro-2-(2-hydroxyethoxymethoxy)ethoxy]-2,2-difluoroethoxy]-2-hydroxypropoxy]-3-prop-2-enoxypropan-2-ol |
|---|---|
| PubChem CID | 157084760 |
| Molecular Formula | C16H28F4O9 |
| Molecular Weight | 440.38 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | 1-[3-[2-[1,1-difluoro-2-(2-hydroxyethoxymethoxy)ethoxy]-2,2-difluoroethoxy]-2-hydroxypropoxy]-3-prop-2-enoxypropan-2-ol |
| SMILES | C=CCOCC(O)COCC(O)COCC(F)(F)OC(F)(F)COCOCCO |
| InChI | InChI=1S/C16H28F4O9/c1-2-4-24-6-13(22)7-26-8-14(23)9-27-10-15(17,18)29-16(19,20)11-28-12-25-5-3-21/h2,13-14,21-23H,1,3-12H2 |
| InChIKey | MGEUVGPVFBYYFZ-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 116.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.38 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|