C16H26F4O8 — CID 159446000
1-[2-[1,1-difluoro-2-[2-(oxiran-2-ylmethoxy)ethoxymethoxy]ethoxy]-2,2-difluoroethoxy]-3-prop-2-enoxypropan-2-ol (PubChem CID 159446000) has the molecular formula C16H26F4O8 and a molecular weight of 422.37 g/mol. Its IUPAC name is 1-[2-[1,1-difluoro-2-[2-(oxiran-2-ylmethoxy)ethoxymethoxy]ethoxy]-2,2-difluoroethoxy]-3-prop-2-enoxypropan-2-ol.
| Compound Name | 1-[2-[1,1-difluoro-2-[2-(oxiran-2-ylmethoxy)ethoxymethoxy]ethoxy]-2,2-difluoroethoxy]-3-prop-2-enoxypropan-2-ol |
|---|---|
| PubChem CID | 159446000 |
| Molecular Formula | C16H26F4O8 |
| Molecular Weight | 422.37 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | 1-[2-[1,1-difluoro-2-[2-(oxiran-2-ylmethoxy)ethoxymethoxy]ethoxy]-2,2-difluoroethoxy]-3-prop-2-enoxypropan-2-ol |
| SMILES | C=CCOCC(O)COCC(F)(F)OC(F)(F)COCOCCOCC1CO1 |
| InChI | InChI=1S/C16H26F4O8/c1-2-3-22-6-13(21)7-25-10-15(17,18)28-16(19,20)11-26-12-24-5-4-23-8-14-9-27-14/h2,13-14,21H,1,3-12H2 |
| InChIKey | LSTRINHWDRAVNQ-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 88.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.37 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|