C19H31F4NO9 — CID 158041040
3-[3-[2-[[2-[1,1-difluoro-2-(2-hydroxy-3-prop-2-enoxypropoxy)ethoxy]-2,2-difluoroethoxy]methoxy]ethoxy]-2-hydroxypropoxy]propanenitrile (PubChem CID 158041040) has the molecular formula C19H31F4NO9 and a molecular weight of 493.45 g/mol. Its IUPAC name is 3-[3-[2-[[2-[1,1-difluoro-2-(2-hydroxy-3-prop-2-enoxypropoxy)ethoxy]-2,2-difluoroethoxy]methoxy]ethoxy]-2-hydroxypropoxy]propanenitrile.
| Compound Name | 3-[3-[2-[[2-[1,1-difluoro-2-(2-hydroxy-3-prop-2-enoxypropoxy)ethoxy]-2,2-difluoroethoxy]methoxy]ethoxy]-2-hydroxypropoxy]propanenitrile |
|---|---|
| PubChem CID | 158041040 |
| Molecular Formula | C19H31F4NO9 |
| Molecular Weight | 493.45 g/mol |
| Exact Mass | 493.19 |
| IUPAC Name | 3-[3-[2-[[2-[1,1-difluoro-2-(2-hydroxy-3-prop-2-enoxypropoxy)ethoxy]-2,2-difluoroethoxy]methoxy]ethoxy]-2-hydroxypropoxy]propanenitrile |
| SMILES | C=CCOCC(O)COCC(F)(F)OC(F)(F)COCOCCOCC(O)COCCC#N |
| InChI | InChI=1S/C19H31F4NO9/c1-2-5-27-9-17(26)12-31-13-18(20,21)33-19(22,23)14-32-15-30-8-7-29-11-16(25)10-28-6-3-4-24/h2,16-17,25-26H,1,3,5-15H2 |
| InChIKey | FIIWLFFQWMZXFP-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 128.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.45 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|