C22H38F4O11 — CID 158854667
1-[2-[[2-[1,1-difluoro-2-[2-hydroxy-3-(2-hydroxy-3-prop-2-enoxypropoxy)propoxy]ethoxy]-2,2-difluoroethoxy]methoxy]ethoxy]-3-prop-2-enoxypropan-2-ol (PubChem CID 158854667) has the molecular formula C22H38F4O11 and a molecular weight of 554.53 g/mol. Its IUPAC name is 1-[2-[[2-[1,1-difluoro-2-[2-hydroxy-3-(2-hydroxy-3-prop-2-enoxypropoxy)propoxy]ethoxy]-2,2-difluoroethoxy]methoxy]ethoxy]-3-prop-2-enoxypropan-2-ol.
| Compound Name | 1-[2-[[2-[1,1-difluoro-2-[2-hydroxy-3-(2-hydroxy-3-prop-2-enoxypropoxy)propoxy]ethoxy]-2,2-difluoroethoxy]methoxy]ethoxy]-3-prop-2-enoxypropan-2-ol |
|---|---|
| PubChem CID | 158854667 |
| Molecular Formula | C22H38F4O11 |
| Molecular Weight | 554.53 g/mol |
| Exact Mass | 554.24 |
| IUPAC Name | 1-[2-[[2-[1,1-difluoro-2-[2-hydroxy-3-(2-hydroxy-3-prop-2-enoxypropoxy)propoxy]ethoxy]-2,2-difluoroethoxy]methoxy]ethoxy]-3-prop-2-enoxypropan-2-ol |
| SMILES | C=CCOCC(O)COCCOCOCC(F)(F)OC(F)(F)COCC(O)COCC(O)COCC=C |
| InChI | InChI=1S/C22H38F4O11/c1-3-5-30-9-18(27)11-32-7-8-33-17-36-16-22(25,26)37-21(23,24)15-35-14-20(29)13-34-12-19(28)10-31-6-4-2/h3-4,18-20,27-29H,1-2,5-17H2 |
| InChIKey | IZWXHUMOKWIEED-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 134.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.53 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|