C19H30F4O9 — CID 159301317
1-[2-[[2-[1,1-difluoro-2-(2-hydroxy-3-prop-2-enoxypropoxy)ethoxy]-2,2-difluoroethoxy]methoxy]ethoxy]-3-prop-2-ynoxypropan-2-ol (PubChem CID 159301317) has the molecular formula C19H30F4O9 and a molecular weight of 478.43 g/mol. Its IUPAC name is 1-[2-[[2-[1,1-difluoro-2-(2-hydroxy-3-prop-2-enoxypropoxy)ethoxy]-2,2-difluoroethoxy]methoxy]ethoxy]-3-prop-2-ynoxypropan-2-ol.
| Compound Name | 1-[2-[[2-[1,1-difluoro-2-(2-hydroxy-3-prop-2-enoxypropoxy)ethoxy]-2,2-difluoroethoxy]methoxy]ethoxy]-3-prop-2-ynoxypropan-2-ol |
|---|---|
| PubChem CID | 159301317 |
| Molecular Formula | C19H30F4O9 |
| Molecular Weight | 478.43 g/mol |
| Exact Mass | 478.18 |
| IUPAC Name | 1-[2-[[2-[1,1-difluoro-2-(2-hydroxy-3-prop-2-enoxypropoxy)ethoxy]-2,2-difluoroethoxy]methoxy]ethoxy]-3-prop-2-ynoxypropan-2-ol |
| SMILES | C#CCOCC(O)COCCOCOCC(F)(F)OC(F)(F)COCC(O)COCC=C |
| InChI | InChI=1S/C19H30F4O9/c1-3-5-26-9-16(24)11-28-7-8-29-15-31-14-19(22,23)32-18(20,21)13-30-12-17(25)10-27-6-4-2/h1,4,16-17,24-25H,2,5-15H2 |
| InChIKey | LBJJMNOGPJCUEW-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 105.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.43 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|