C19H29F4NO10 — CID 158000131
[3-[2-[[2-[1,1-difluoro-2-(2-hydroxy-3-prop-2-enoxypropoxy)ethoxy]-2,2-difluoroethoxy]methoxy]ethoxy]-2-hydroxypropyl] 2-cyanoacetate (PubChem CID 158000131) has the molecular formula C19H29F4NO10 and a molecular weight of 507.43 g/mol. Its IUPAC name is [3-[2-[[2-[1,1-difluoro-2-(2-hydroxy-3-prop-2-enoxypropoxy)ethoxy]-2,2-difluoroethoxy]methoxy]ethoxy]-2-hydroxypropyl] 2-cyanoacetate.
| Compound Name | [3-[2-[[2-[1,1-difluoro-2-(2-hydroxy-3-prop-2-enoxypropoxy)ethoxy]-2,2-difluoroethoxy]methoxy]ethoxy]-2-hydroxypropyl] 2-cyanoacetate |
|---|---|
| PubChem CID | 158000131 |
| Molecular Formula | C19H29F4NO10 |
| Molecular Weight | 507.43 g/mol |
| Exact Mass | 507.17 |
| IUPAC Name | [3-[2-[[2-[1,1-difluoro-2-(2-hydroxy-3-prop-2-enoxypropoxy)ethoxy]-2,2-difluoroethoxy]methoxy]ethoxy]-2-hydroxypropyl] 2-cyanoacetate |
| SMILES | C=CCOCC(O)COCC(F)(F)OC(F)(F)COCOCCOCC(O)COC(=O)CC#N |
| InChI | InChI=1S/C19H29F4NO10/c1-2-5-28-8-15(25)10-31-12-18(20,21)34-19(22,23)13-32-14-30-7-6-29-9-16(26)11-33-17(27)3-4-24/h2,15-16,25-26H,1,3,5-14H2 |
| InChIKey | FDQAXJSOQXBSBO-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 145.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.43 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|