C12H15IN4O4 — CID 158711948
ethyl 4-iodo-1H-pyrazole-5-carboxylate;ethyl 1H-pyrazole-5-carboxylate (PubChem CID 158711948) has the molecular formula C12H15IN4O4 and a molecular weight of 406.18 g/mol. Its IUPAC name is ethyl 4-iodo-1H-pyrazole-5-carboxylate;ethyl 1H-pyrazole-5-carboxylate.
| Compound Name | ethyl 4-iodo-1H-pyrazole-5-carboxylate;ethyl 1H-pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 158711948 |
| Molecular Formula | C12H15IN4O4 |
| Molecular Weight | 406.18 g/mol |
| Exact Mass | 406.01 |
| IUPAC Name | ethyl 4-iodo-1H-pyrazole-5-carboxylate;ethyl 1H-pyrazole-5-carboxylate |
| SMILES | CCOC(=O)c1[nH]ncc1I.CCOC(=O)c1ccn[nH]1 |
| InChI | InChI=1S/C6H7IN2O2.C6H8N2O2/c1-2-11-6(10)5-4(7)3-8-9-5;1-2-10-6(9)5-3-4-7-8-5/h3H,2H2,1H3,(H,8,9);3-4H,2H2,1H3,(H,7,8) |
| InChIKey | IIVKACYRPIGHFC-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 109.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.18 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|