C16H9F5N4O4 — CID 158712617
N-(5-cyano-2-fluorophenyl)-2,2,2-trifluoroacetamide;4-fluoro-3-nitrobenzamide (PubChem CID 158712617) has the molecular formula C16H9F5N4O4 and a molecular weight of 416.26 g/mol. Its IUPAC name is N-(5-cyano-2-fluorophenyl)-2,2,2-trifluoroacetamide;4-fluoro-3-nitrobenzamide.
| Compound Name | N-(5-cyano-2-fluorophenyl)-2,2,2-trifluoroacetamide;4-fluoro-3-nitrobenzamide |
|---|---|
| PubChem CID | 158712617 |
| Molecular Formula | C16H9F5N4O4 |
| Molecular Weight | 416.26 g/mol |
| Exact Mass | 416.05 |
| IUPAC Name | N-(5-cyano-2-fluorophenyl)-2,2,2-trifluoroacetamide;4-fluoro-3-nitrobenzamide |
| SMILES | N#Cc1ccc(F)c(NC(=O)C(F)(F)F)c1.NC(=O)c1ccc(F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C9H4F4N2O.C7H5FN2O3/c10-6-2-1-5(4-14)3-7(6)15-8(16)9(11,12)13;8-5-2-1-4(7(9)11)3-6(5)10(12)13/h1-3H,(H,15,16);1-3H,(H2,9,11) |
| InChIKey | IIXLTOACBTYNAV-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 139.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.26 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|