C29H24Cl2N6O2 — CID 158719632
6-chloro-3-cyclopropyl-4-phenylmethoxyimidazo[4,5-c]pyridine;6-chloro-4-phenylmethoxy-1H-imidazo[4,5-c]pyridine (PubChem CID 158719632) has the molecular formula C29H24Cl2N6O2 and a molecular weight of 559.46 g/mol. Its IUPAC name is 6-chloro-3-cyclopropyl-4-phenylmethoxyimidazo[4,5-c]pyridine;6-chloro-4-phenylmethoxy-1H-imidazo[4,5-c]pyridine.
| Compound Name | 6-chloro-3-cyclopropyl-4-phenylmethoxyimidazo[4,5-c]pyridine;6-chloro-4-phenylmethoxy-1H-imidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 158719632 |
| Molecular Formula | C29H24Cl2N6O2 |
| Molecular Weight | 559.46 g/mol |
| Exact Mass | 558.13 |
| IUPAC Name | 6-chloro-3-cyclopropyl-4-phenylmethoxyimidazo[4,5-c]pyridine;6-chloro-4-phenylmethoxy-1H-imidazo[4,5-c]pyridine |
| SMILES | Clc1cc2[nH]cnc2c(OCc2ccccc2)n1.Clc1cc2ncn(C3CC3)c2c(OCc2ccccc2)n1 |
| InChI | InChI=1S/C16H14ClN3O.C13H10ClN3O/c17-14-8-13-15(20(10-18-13)12-6-7-12)16(19-14)21-9-11-4-2-1-3-5-11;14-11-6-10-12(16-8-15-10)13(17-11)18-7-9-4-2-1-3-5-9/h1-5,8,10,12H,6-7,9H2;1-6,8H,7H2,(H,15,16) |
| InChIKey | IJTCEFDMUCMNPO-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 90.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.46 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|