C19H14ClN3O — CID 164548917
6-chloro-1-phenyl-3-phenylmethoxypyrazolo[4,3-c]pyridine (PubChem CID 164548917) has the molecular formula C19H14ClN3O and a molecular weight of 335.79 g/mol. Its IUPAC name is 6-chloro-1-phenyl-3-phenylmethoxypyrazolo[4,3-c]pyridine.
| Compound Name | 6-chloro-1-phenyl-3-phenylmethoxypyrazolo[4,3-c]pyridine |
|---|---|
| PubChem CID | 164548917 |
| Molecular Formula | C19H14ClN3O |
| Molecular Weight | 335.79 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | 6-chloro-1-phenyl-3-phenylmethoxypyrazolo[4,3-c]pyridine |
| SMILES | Clc1cc2c(cn1)c(OCc1ccccc1)nn2-c1ccccc1 |
| InChI | InChI=1S/C19H14ClN3O/c20-18-11-17-16(12-21-18)19(24-13-14-7-3-1-4-8-14)22-23(17)15-9-5-2-6-10-15/h1-12H,13H2 |
| InChIKey | RFDWJEJZQOSRIU-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.79 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|