C25H31F2N7O2 — CID 158719759
3-fluoro-4-(morpholin-4-ylmethyl)aniline;[3-fluoro-4-(morpholin-4-ylmethyl)phenyl]-(1H-pyrazol-4-yl)diazene (PubChem CID 158719759) has the molecular formula C25H31F2N7O2 and a molecular weight of 499.57 g/mol. Its IUPAC name is 3-fluoro-4-(morpholin-4-ylmethyl)aniline;[3-fluoro-4-(morpholin-4-ylmethyl)phenyl]-(1H-pyrazol-4-yl)diazene.
| Compound Name | 3-fluoro-4-(morpholin-4-ylmethyl)aniline;[3-fluoro-4-(morpholin-4-ylmethyl)phenyl]-(1H-pyrazol-4-yl)diazene |
|---|---|
| PubChem CID | 158719759 |
| Molecular Formula | C25H31F2N7O2 |
| Molecular Weight | 499.57 g/mol |
| Exact Mass | 499.25 |
| IUPAC Name | 3-fluoro-4-(morpholin-4-ylmethyl)aniline;[3-fluoro-4-(morpholin-4-ylmethyl)phenyl]-(1H-pyrazol-4-yl)diazene |
| SMILES | Fc1cc(/N=N/c2cn[nH]c2)ccc1CN1CCOCC1.Nc1ccc(CN2CCOCC2)c(F)c1 |
| InChI | InChI=1S/C14H16FN5O.C11H15FN2O/c15-14-7-12(18-19-13-8-16-17-9-13)2-1-11(14)10-20-3-5-21-6-4-20;12-11-7-10(13)2-1-9(11)8-14-3-5-15-6-4-14/h1-2,7-9H,3-6,10H2,(H,16,17);1-2,7H,3-6,8,13H2/b19-18+; |
| InChIKey | MLDHISSPYBXAOP-LTRPLHCISA-N |
| XLogP | 4.04 |
| TPSA | 104.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.57 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|