C21H28F12N4O6 — CID 158720016
4-O-tert-butyl 1-O-(1,1,1,3,3,3-hexafluoropropan-2-yl) piperazine-1,4-dicarboxylate;1,1,1,3,3,3-hexafluoropropan-2-yl piperazine-1-carboxylate (PubChem CID 158720016) has the molecular formula C21H28F12N4O6 and a molecular weight of 660.45 g/mol. Its IUPAC name is 4-O-tert-butyl 1-O-(1,1,1,3,3,3-hexafluoropropan-2-yl) piperazine-1,4-dicarboxylate;1,1,1,3,3,3-hexafluoropropan-2-yl piperazine-1-carboxylate.
| Compound Name | 4-O-tert-butyl 1-O-(1,1,1,3,3,3-hexafluoropropan-2-yl) piperazine-1,4-dicarboxylate;1,1,1,3,3,3-hexafluoropropan-2-yl piperazine-1-carboxylate |
|---|---|
| PubChem CID | 158720016 |
| Molecular Formula | C21H28F12N4O6 |
| Molecular Weight | 660.45 g/mol |
| Exact Mass | 660.18 |
| IUPAC Name | 4-O-tert-butyl 1-O-(1,1,1,3,3,3-hexafluoropropan-2-yl) piperazine-1,4-dicarboxylate;1,1,1,3,3,3-hexafluoropropan-2-yl piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(C(=O)OC(C(F)(F)F)C(F)(F)F)CC1.O=C(OC(C(F)(F)F)C(F)(F)F)N1CCNCC1 |
| InChI | InChI=1S/C13H18F6N2O4.C8H10F6N2O2/c1-11(2,3)25-10(23)21-6-4-20(5-7-21)9(22)24-8(12(14,15)16)13(17,18)19;9-7(10,11)5(8(12,13)14)18-6(17)16-3-1-15-2-4-16/h8H,4-7H2,1-3H3;5,15H,1-4H2 |
| InChIKey | IJUILWMQRBDZAN-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 100.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.45 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|