C25H38F12N4O7 — CID 158926729
4-O-tert-butyl 1-O-(1,1,1,3,3,3-hexafluoropropan-2-yl) piperazine-1,4-dicarboxylate;tert-butyl piperazine-1-carboxylate;1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 158926729) has the molecular formula C25H38F12N4O7 and a molecular weight of 734.58 g/mol. Its IUPAC name is 4-O-tert-butyl 1-O-(1,1,1,3,3,3-hexafluoropropan-2-yl) piperazine-1,4-dicarboxylate;tert-butyl piperazine-1-carboxylate;1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 4-O-tert-butyl 1-O-(1,1,1,3,3,3-hexafluoropropan-2-yl) piperazine-1,4-dicarboxylate;tert-butyl piperazine-1-carboxylate;1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 158926729 |
| Molecular Formula | C25H38F12N4O7 |
| Molecular Weight | 734.58 g/mol |
| Exact Mass | 734.25 |
| IUPAC Name | 4-O-tert-butyl 1-O-(1,1,1,3,3,3-hexafluoropropan-2-yl) piperazine-1,4-dicarboxylate;tert-butyl piperazine-1-carboxylate;1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | CC(C)(C)OC(=O)N1CCN(C(=O)OC(C(F)(F)F)C(F)(F)F)CC1.CC(C)(C)OC(=O)N1CCNCC1.OC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C13H18F6N2O4.C9H18N2O2.C3H2F6O/c1-11(2,3)25-10(23)21-6-4-20(5-7-21)9(22)24-8(12(14,15)16)13(17,18)19;1-9(2,3)13-8(12)11-6-4-10-5-7-11;4-2(5,6)1(10)3(7,8)9/h8H,4-7H2,1-3H3;10H,4-7H2,1-3H3;1,10H |
| InChIKey | JINQMGWZYBFFDU-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 120.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.58 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|