C50H48N4O9S — CID 158722412
7-[4-[[3-(4-hydroxyphenyl)phenyl]methyl]piperazin-1-yl]-3H-1-benzofuran-2-one;[4-[3-[[4-(2-oxo-3H-1-benzofuran-7-yl)piperazin-1-yl]methyl]phenyl]phenyl] hydrogen sulfate (PubChem CID 158722412) has the molecular formula C50H48N4O9S and a molecular weight of 881.02 g/mol. Its IUPAC name is 7-[4-[[3-(4-hydroxyphenyl)phenyl]methyl]piperazin-1-yl]-3H-1-benzofuran-2-one;[4-[3-[[4-(2-oxo-3H-1-benzofuran-7-yl)piperazin-1-yl]methyl]phenyl]phenyl] hydrogen sulfate.
| Compound Name | 7-[4-[[3-(4-hydroxyphenyl)phenyl]methyl]piperazin-1-yl]-3H-1-benzofuran-2-one;[4-[3-[[4-(2-oxo-3H-1-benzofuran-7-yl)piperazin-1-yl]methyl]phenyl]phenyl] hydrogen sulfate |
|---|---|
| PubChem CID | 158722412 |
| Molecular Formula | C50H48N4O9S |
| Molecular Weight | 881.02 g/mol |
| Exact Mass | 880.31 |
| IUPAC Name | 7-[4-[[3-(4-hydroxyphenyl)phenyl]methyl]piperazin-1-yl]-3H-1-benzofuran-2-one;[4-[3-[[4-(2-oxo-3H-1-benzofuran-7-yl)piperazin-1-yl]methyl]phenyl]phenyl] hydrogen sulfate |
| SMILES | O=C1Cc2cccc(N3CCN(Cc4cccc(-c5ccc(O)cc5)c4)CC3)c2O1.O=C1Cc2cccc(N3CCN(Cc4cccc(-c5ccc(OS(=O)(=O)O)cc5)c4)CC3)c2O1 |
| InChI | InChI=1S/C25H24N2O6S.C25H24N2O3/c28-24-16-21-5-2-6-23(25(21)32-24)27-13-11-26(12-14-27)17-18-3-1-4-20(15-18)19-7-9-22(10-8-19)33-34(29,30)31;28-22-9-7-19(8-10-22)20-4-1-3-18(15-20)17-26-11-13-27(14-12-26)23-6-2-5-21-16-24(29)30-25(21)23/h1-10,15H,11-14,16-17H2,(H,29,30,31);1-10,15,28H,11-14,16-17H2 |
| InChIKey | IKBRLTCTCBXHQQ-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 149.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 64 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 881.02 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|