C30H39F6N5O — CID 15872242
N-[2-[3,5-bis(trifluoromethyl)phenyl]ethyl]-2-[4-(N-tert-butyl-N'-ethylcarbamimidoyl)piperazin-1-yl]-N-methyl-2-phenylacetamide (PubChem CID 15872242) has the molecular formula C30H39F6N5O and a molecular weight of 599.66 g/mol. Its IUPAC name is N-[2-[3,5-bis(trifluoromethyl)phenyl]ethyl]-2-[4-(N-tert-butyl-N'-ethylcarbamimidoyl)piperazin-1-yl]-N-methyl-2-phenylacetamide.
| Compound Name | N-[2-[3,5-bis(trifluoromethyl)phenyl]ethyl]-2-[4-(N-tert-butyl-N'-ethylcarbamimidoyl)piperazin-1-yl]-N-methyl-2-phenylacetamide |
|---|---|
| PubChem CID | 15872242 |
| Molecular Formula | C30H39F6N5O |
| Molecular Weight | 599.66 g/mol |
| Exact Mass | 599.31 |
| IUPAC Name | N-[2-[3,5-bis(trifluoromethyl)phenyl]ethyl]-2-[4-(N-tert-butyl-N'-ethylcarbamimidoyl)piperazin-1-yl]-N-methyl-2-phenylacetamide |
| SMILES | CC/N=C(\NC(C)(C)C)N1CCN(C(C(=O)N(C)CCc2cc(C(F)(F)F)cc(C(F)(F)F)c2)c2ccccc2)CC1 |
| InChI | InChI=1S/C30H39F6N5O/c1-6-37-27(38-28(2,3)4)41-16-14-40(15-17-41)25(22-10-8-7-9-11-22)26(42)39(5)13-12-21-18-23(29(31,32)33)20-24(19-21)30(34,35)36/h7-11,18-20,25H,6,12-17H2,1-5H3,(H,37,38) |
| InChIKey | ZXYXBAQOVVSYMF-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 51.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.66 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|