C28H35BN2O4 — CID 158730159
tert-butyl (1R,3S,5R)-3-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-benzo[e]indol-2-yl]-2-azabicyclo[3.1.0]hexane-2-carboxylate (PubChem CID 158730159) has the molecular formula C28H35BN2O4 and a molecular weight of 474.41 g/mol. Its IUPAC name is tert-butyl (1R,3S,5R)-3-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-benzo[e]indol-2-yl]-2-azabicyclo[3.1.0]hexane-2-carboxylate.
| Compound Name | tert-butyl (1R,3S,5R)-3-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-benzo[e]indol-2-yl]-2-azabicyclo[3.1.0]hexane-2-carboxylate |
|---|---|
| PubChem CID | 158730159 |
| Molecular Formula | C28H35BN2O4 |
| Molecular Weight | 474.41 g/mol |
| Exact Mass | 474.27 |
| IUPAC Name | tert-butyl (1R,3S,5R)-3-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-benzo[e]indol-2-yl]-2-azabicyclo[3.1.0]hexane-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@@H]2C[C@@H]2C[C@H]1C1=Nc2ccc3cc(B4OC(C)(C)C(C)(C)O4)ccc3c2C1 |
| InChI | InChI=1S/C28H35BN2O4/c1-26(2,3)33-25(32)31-23-13-17(23)14-24(31)22-15-20-19-10-9-18(12-16(19)8-11-21(20)30-22)29-34-27(4,5)28(6,7)35-29/h8-12,17,23-24H,13-15H2,1-7H3/t17-,23-,24+/m1/s1 |
| InChIKey | HEWLQRGJKMEVSZ-VEYWIMSWSA-N |
| XLogP | 5.17 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.41 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|