C23H25N3O4S — CID 158732967
3,4-dimethoxy-N-(5-propan-2-yl-1,3,4-thiadiazol-2-yl)benzamide;7-methoxyocta-1,2,3,4,5,7-hexaene (PubChem CID 158732967) has the molecular formula C23H25N3O4S and a molecular weight of 439.54 g/mol. Its IUPAC name is 3,4-dimethoxy-N-(5-propan-2-yl-1,3,4-thiadiazol-2-yl)benzamide;7-methoxyocta-1,2,3,4,5,7-hexaene.
| Compound Name | 3,4-dimethoxy-N-(5-propan-2-yl-1,3,4-thiadiazol-2-yl)benzamide;7-methoxyocta-1,2,3,4,5,7-hexaene |
|---|---|
| PubChem CID | 158732967 |
| Molecular Formula | C23H25N3O4S |
| Molecular Weight | 439.54 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | 3,4-dimethoxy-N-(5-propan-2-yl-1,3,4-thiadiazol-2-yl)benzamide;7-methoxyocta-1,2,3,4,5,7-hexaene |
| SMILES | C=C=C=C=C=CC(=C)OC.COc1ccc(C(=O)Nc2nnc(C(C)C)s2)cc1OC |
| InChI | InChI=1S/C14H17N3O3S.C9H8O/c1-8(2)13-16-17-14(21-13)15-12(18)9-5-6-10(19-3)11(7-9)20-4;1-4-5-6-7-8-9(2)10-3/h5-8H,1-4H3,(H,15,17,18);8H,1-2H2,3H3 |
| InChIKey | ILICRUKKIXIBNH-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 82.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.54 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|