C15H18 — CID 158734941
2-methyl-5-pent-1-ynyl-2,3-dihydro-1H-indene (PubChem CID 158734941) has the molecular formula C15H18 and a molecular weight of 198.31 g/mol. Its IUPAC name is 2-methyl-5-pent-1-ynyl-2,3-dihydro-1H-indene.
| Compound Name | 2-methyl-5-pent-1-ynyl-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 158734941 |
| Molecular Formula | C15H18 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | 2-methyl-5-pent-1-ynyl-2,3-dihydro-1H-indene |
| SMILES | CCCC#Cc1ccc2c(c1)CC(C)C2 |
| InChI | InChI=1S/C15H18/c1-3-4-5-6-13-7-8-14-9-12(2)10-15(14)11-13/h7-8,11-12H,3-4,9-10H2,1-2H3 |
| InChIKey | ARPDQHGDRHBEFP-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|