C66H60Se — CID 158735479
2-[10-(3-tert-butyl-5-ethylphenyl)anthracen-9-yl]-6-[10-(3,5-ditert-butylphenyl)anthracen-9-yl]dibenzoselenophene (PubChem CID 158735479) has the molecular formula C66H60Se and a molecular weight of 932.17 g/mol. Its IUPAC name is 2-[10-(3-tert-butyl-5-ethylphenyl)anthracen-9-yl]-6-[10-(3,5-ditert-butylphenyl)anthracen-9-yl]dibenzoselenophene.
| Compound Name | 2-[10-(3-tert-butyl-5-ethylphenyl)anthracen-9-yl]-6-[10-(3,5-ditert-butylphenyl)anthracen-9-yl]dibenzoselenophene |
|---|---|
| PubChem CID | 158735479 |
| Molecular Formula | C66H60Se |
| Molecular Weight | 932.17 g/mol |
| Exact Mass | 932.39 |
| IUPAC Name | 2-[10-(3-tert-butyl-5-ethylphenyl)anthracen-9-yl]-6-[10-(3,5-ditert-butylphenyl)anthracen-9-yl]dibenzoselenophene |
| SMILES | CCc1cc(-c2c3ccccc3c(-c3ccc4[se]c5c(-c6c7ccccc7c(-c7cc(C(C)(C)C)cc(C(C)(C)C)c7)c7ccccc67)cccc5c4c3)c3ccccc23)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C66H60Se/c1-11-40-33-42(35-44(34-40)64(2,3)4)60-49-23-14-12-21-47(49)59(48-22-13-15-24-50(48)60)41-31-32-58-57(38-41)55-29-20-30-56(63(55)67-58)62-53-27-18-16-25-51(53)61(52-26-17-19-28-54(52)62)43-36-45(65(5,6)7)39-46(37-43)66(8,9)10/h12-39H,11H2,1-10H3 |
| InChIKey | KZLOGWZCYBYMCE-UHFFFAOYSA-N |
| XLogP | 18.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 932.17 |
| LogP ≤ 5 | 18.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|