C21H30BrNO5Si — CID 158743523
methyl (2S,3S)-3-[bromomethyl(dimethyl)silyl]oxy-2-ethyl-1-[(4-methoxyphenyl)methyl]-3-methyl-4-methylidene-5-oxopyrrolidine-2-carboxylate (PubChem CID 158743523) has the molecular formula C21H30BrNO5Si and a molecular weight of 484.46 g/mol. Its IUPAC name is methyl (2S,3S)-3-[bromomethyl(dimethyl)silyl]oxy-2-ethyl-1-[(4-methoxyphenyl)methyl]-3-methyl-4-methylidene-5-oxopyrrolidine-2-carboxylate.
| Compound Name | methyl (2S,3S)-3-[bromomethyl(dimethyl)silyl]oxy-2-ethyl-1-[(4-methoxyphenyl)methyl]-3-methyl-4-methylidene-5-oxopyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 158743523 |
| Molecular Formula | C21H30BrNO5Si |
| Molecular Weight | 484.46 g/mol |
| Exact Mass | 483.11 |
| IUPAC Name | methyl (2S,3S)-3-[bromomethyl(dimethyl)silyl]oxy-2-ethyl-1-[(4-methoxyphenyl)methyl]-3-methyl-4-methylidene-5-oxopyrrolidine-2-carboxylate |
| SMILES | C=C1C(=O)N(Cc2ccc(OC)cc2)[C@](CC)(C(=O)OC)[C@@]1(C)O[Si](C)(C)CBr |
| InChI | InChI=1S/C21H30BrNO5Si/c1-8-21(19(25)27-5)20(3,28-29(6,7)14-22)15(2)18(24)23(21)13-16-9-11-17(26-4)12-10-16/h9-12H,2,8,13-14H2,1,3-7H3/t20-,21+/m0/s1 |
| InChIKey | IMPGULSZMFYRTA-LEWJYISDSA-N |
| XLogP | 3.83 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.46 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|