C25H26N4O2 — CID 158745649
2,4-dimethylpyrido[1,2-a]pyrimidin-5-ium-3-olate;2,4-dimethylpyrimido[2,1-a]isoquinolin-5-ium-3-olate;methane (PubChem CID 158745649) has the molecular formula C25H26N4O2 and a molecular weight of 414.51 g/mol. Its IUPAC name is 2,4-dimethylpyrido[1,2-a]pyrimidin-5-ium-3-olate;2,4-dimethylpyrimido[2,1-a]isoquinolin-5-ium-3-olate;methane.
| Compound Name | 2,4-dimethylpyrido[1,2-a]pyrimidin-5-ium-3-olate;2,4-dimethylpyrimido[2,1-a]isoquinolin-5-ium-3-olate;methane |
|---|---|
| PubChem CID | 158745649 |
| Molecular Formula | C25H26N4O2 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | 2,4-dimethylpyrido[1,2-a]pyrimidin-5-ium-3-olate;2,4-dimethylpyrimido[2,1-a]isoquinolin-5-ium-3-olate;methane |
| SMILES | C.Cc1nc2c3ccccc3cc[n+]2c(C)c1[O-].Cc1nc2cccc[n+]2c(C)c1[O-] |
| InChI | InChI=1S/C14H12N2O.C10H10N2O.CH4/c1-9-13(17)10(2)16-8-7-11-5-3-4-6-12(11)14(16)15-9;1-7-10(13)8(2)12-6-4-3-5-9(12)11-7;/h3-8H,1-2H3;3-6H,1-2H3;1H4 |
| InChIKey | IMVVTCGZHSQJDO-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 80.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_B(2)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|