C15H10N3+ — CID 53356369
8,9-diaza-2-azoniatetracyclo[8.8.0.02,7.011,16]octadeca-1(10),2,4,6,8,11,13,15,17-nonaene (PubChem CID 53356369) has the molecular formula C15H10N3+ and a molecular weight of 232.27 g/mol. Its IUPAC name is 8,9-diaza-2-azoniatetracyclo[8.8.0.02,7.011,16]octadeca-1(10),2,4,6,8,11,13,15,17-nonaene.
| Compound Name | 8,9-diaza-2-azoniatetracyclo[8.8.0.02,7.011,16]octadeca-1(10),2,4,6,8,11,13,15,17-nonaene |
|---|---|
| PubChem CID | 53356369 |
| Molecular Formula | C15H10N3+ |
| Molecular Weight | 232.27 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | 8,9-diaza-2-azoniatetracyclo[8.8.0.02,7.011,16]octadeca-1(10),2,4,6,8,11,13,15,17-nonaene |
| SMILES | c1ccc2c(c1)ccc1c2nnc2cccc[n+]21 |
| InChI | InChI=1S/C15H10N3/c1-2-6-12-11(5-1)8-9-13-15(12)17-16-14-7-3-4-10-18(13)14/h1-10H/q+1 |
| InChIKey | DOMUYZALGRDQDB-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 29.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.27 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|