C16H22N3+ — CID 90694366
butane;2,3-dimethylbenzo[e]benzotriazol-3-ium (PubChem CID 90694366) has the molecular formula C16H22N3+ and a molecular weight of 256.37 g/mol. Its IUPAC name is butane;2,3-dimethylbenzo[e]benzotriazol-3-ium.
| Compound Name | butane;2,3-dimethylbenzo[e]benzotriazol-3-ium |
|---|---|
| PubChem CID | 90694366 |
| Molecular Formula | C16H22N3+ |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.18 |
| IUPAC Name | butane;2,3-dimethylbenzo[e]benzotriazol-3-ium |
| SMILES | CCCC.Cn1nc2c3ccccc3ccc2[n+]1C |
| InChI | InChI=1S/C12H12N3.C4H10/c1-14-11-8-7-9-5-3-4-6-10(9)12(11)13-15(14)2;1-3-4-2/h3-8H,1-2H3;3-4H2,1-2H3/q+1; |
| InChIKey | HVXJHKJSZRZLBV-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|