About cyclopenta[i][1,2]benzodiazepine
cyclopenta[i][1,2]benzodiazepine (PubChem CID 150279763) has the molecular formula C12H8N2
and a molecular weight of 180.21 g/mol. Its IUPAC name is cyclopenta[i][1,2]benzodiazepine.
Molecular Properties
| Compound Name | cyclopenta[i][1,2]benzodiazepine |
| PubChem CID | 150279763 |
| Molecular Formula | C12H8N2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.07 |
| IUPAC Name | cyclopenta[i][1,2]benzodiazepine |
| SMILES | c1cnnc2c(c1)ccc1cccc12 |
| InChI | InChI=1S/C12H8N2/c1-3-9-6-7-10-4-2-8-13-14-12(10)11(9)5-1/h1-8H |
| InChIKey | GFIFHCOMAJAGIY-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cyclopenta[i][1,2]benzodiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopenta[i][1,2]benzodiazepine?
The IUPAC name of cyclopenta[i][1,2]benzodiazepine (CID 150279763) is cyclopenta[i][1,2]benzodiazepine.
What is the SMILES notation for cyclopenta[i][1,2]benzodiazepine?
The canonical SMILES for cyclopenta[i][1,2]benzodiazepine is c1cnnc2c(c1)ccc1cccc12.
What is the InChIKey of cyclopenta[i][1,2]benzodiazepine?
The InChIKey is GFIFHCOMAJAGIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N2/c1-3-9-6-7-10-4-2-8-13-14-12(10)11(9)5-1/h1-8H.
What are the key properties of cyclopenta[i][1,2]benzodiazepine?
cyclopenta[i][1,2]benzodiazepine has a molecular weight of 180.21 g/mol, XLogP of 2.78, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopenta[i][1,2]benzodiazepine is sourced from PubChem (CID 150279763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).