About cinnolin-8-ol;ethane
cinnolin-8-ol;ethane (PubChem CID 136607752) has the molecular formula C10H12N2O
and a molecular weight of 176.22 g/mol. Its IUPAC name is cinnolin-8-ol;ethane.
Molecular Properties
| Compound Name | cinnolin-8-ol;ethane |
| PubChem CID | 136607752 |
| Molecular Formula | C10H12N2O |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | cinnolin-8-ol;ethane |
| SMILES | CC.Oc1cccc2ccnnc12 |
| InChI | InChI=1S/C8H6N2O.C2H6/c11-7-3-1-2-6-4-5-9-10-8(6)7;1-2/h1-5,11H;1-2H3 |
| InChIKey | LASGCARKWLSYOG-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cinnolin-8-ol;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cinnolin-8-ol;ethane?
The IUPAC name of cinnolin-8-ol;ethane (CID 136607752) is cinnolin-8-ol;ethane.
What is the SMILES notation for cinnolin-8-ol;ethane?
The canonical SMILES for cinnolin-8-ol;ethane is CC.Oc1cccc2ccnnc12.
What is the InChIKey of cinnolin-8-ol;ethane?
The InChIKey is LASGCARKWLSYOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2O.C2H6/c11-7-3-1-2-6-4-5-9-10-8(6)7;1-2/h1-5,11H;1-2H3.
What are the key properties of cinnolin-8-ol;ethane?
cinnolin-8-ol;ethane has a molecular weight of 176.22 g/mol, XLogP of 2.36, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cinnolin-8-ol;ethane is sourced from PubChem (CID 136607752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).