About methyl cinnoline-8-carboxylate
methyl cinnoline-8-carboxylate (PubChem CID 133080920) has the molecular formula C10H8N2O2
and a molecular weight of 188.19 g/mol. Its IUPAC name is methyl cinnoline-8-carboxylate.
Molecular Properties
| Compound Name | methyl cinnoline-8-carboxylate |
| PubChem CID | 133080920 |
| Molecular Formula | C10H8N2O2 |
| Molecular Weight | 188.19 g/mol |
| Exact Mass | 188.06 |
| IUPAC Name | methyl cinnoline-8-carboxylate |
| SMILES | COC(=O)c1cccc2ccnnc12 |
| InChI | InChI=1S/C10H8N2O2/c1-14-10(13)8-4-2-3-7-5-6-11-12-9(7)8/h2-6H,1H3 |
| InChIKey | OAFAUKZNZCYPOV-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.19 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl cinnoline-8-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl cinnoline-8-carboxylate?
The IUPAC name of methyl cinnoline-8-carboxylate (CID 133080920) is methyl cinnoline-8-carboxylate.
What is the SMILES notation for methyl cinnoline-8-carboxylate?
The canonical SMILES for methyl cinnoline-8-carboxylate is COC(=O)c1cccc2ccnnc12.
What is the InChIKey of methyl cinnoline-8-carboxylate?
The InChIKey is OAFAUKZNZCYPOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2O2/c1-14-10(13)8-4-2-3-7-5-6-11-12-9(7)8/h2-6H,1H3.
What are the key properties of methyl cinnoline-8-carboxylate?
methyl cinnoline-8-carboxylate has a molecular weight of 188.19 g/mol, XLogP of 1.42, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl cinnoline-8-carboxylate is sourced from PubChem (CID 133080920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).