C12H7N4S+ — CID 102363567
14-thia-12,16,17-triaza-11-azoniatetracyclo[8.7.0.02,7.011,15]heptadeca-1(10),2,4,6,8,11(15),12,16-octaene (PubChem CID 102363567) has the molecular formula C12H7N4S+ and a molecular weight of 239.28 g/mol. Its IUPAC name is 14-thia-12,16,17-triaza-11-azoniatetracyclo[8.7.0.02,7.011,15]heptadeca-1(10),2,4,6,8,11(15),12,16-octaene.
| Compound Name | 14-thia-12,16,17-triaza-11-azoniatetracyclo[8.7.0.02,7.011,15]heptadeca-1(10),2,4,6,8,11(15),12,16-octaene |
|---|---|
| PubChem CID | 102363567 |
| Molecular Formula | C12H7N4S+ |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.04 |
| IUPAC Name | 14-thia-12,16,17-triaza-11-azoniatetracyclo[8.7.0.02,7.011,15]heptadeca-1(10),2,4,6,8,11(15),12,16-octaene |
| SMILES | c1ccc2c(c1)ccc1c2nnc2scn[n+]21 |
| InChI | InChI=1S/C12H7N4S/c1-2-4-9-8(3-1)5-6-10-11(9)14-15-12-16(10)13-7-17-12/h1-7H/q+1 |
| InChIKey | NYJSEXXELSXGSN-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 42.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|