About CID 158748587
CID 158748587 (PubChem CID 158748587) has the molecular formula C20H21B15N
and a molecular weight of 437.58 g/mol.
Molecular Properties
| Compound Name | CID 158748587 |
| PubChem CID | 158748587 |
| Molecular Formula | C20H21B15N |
| Molecular Weight | 437.58 g/mol |
| Exact Mass | 440.31 |
| IUPAC Name | — |
| SMILES | CCCC(C)Cc1ccc(-c2ccc(C#N)cc2)cc1.[B][B]B(B([B])[B])C(B([B])[B])(B([B])[B])B([B])[B] |
| InChI | InChI=1S/C19H21N.CB15/c1-3-4-15(2)13-16-5-9-18(10-6-16)19-11-7-17(14-20)8-12-19;2-11-15(16(9)10)1(12(3)4,13(5)6)14(7)8/h5-12,15H,3-4,13H2,1-2H3; |
| InChIKey | CHMZSYBSHZNKKA-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 437.58 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 158748587 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 158748587?
The IUPAC name of CID 158748587 (CID 158748587) is not available.
What is the SMILES notation for CID 158748587?
The canonical SMILES for CID 158748587 is CCCC(C)Cc1ccc(-c2ccc(C#N)cc2)cc1.[B][B]B(B([B])[B])C(B([B])[B])(B([B])[B])B([B])[B].
What is the InChIKey of CID 158748587?
The InChIKey is CHMZSYBSHZNKKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21N.CB15/c1-3-4-15(2)13-16-5-9-18(10-6-16)19-11-7-17(14-20)8-12-19;2-11-15(16(9)10)1(12(3)4,13(5)6)14(7)8/h5-12,15H,3-4,13H2,1-2H3;.
What are the key properties of CID 158748587?
CID 158748587 has a molecular weight of 437.58 g/mol, XLogP of -0.29, 11 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 158748587 is sourced from PubChem (CID 158748587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).