About 4-chloro-2-methyl-5-phenylthieno[2,3-d]pyrimidine;(2R)-2-methylpiperazine
4-chloro-2-methyl-5-phenylthieno[2,3-d]pyrimidine;(2R)-2-methylpiperazine (PubChem CID 158753076) has the molecular formula C18H21ClN4S
and a molecular weight of 360.91 g/mol. Its IUPAC name is 4-chloro-2-methyl-5-phenylthieno[2,3-d]pyrimidine;(2R)-2-methylpiperazine.
Molecular Properties
| Compound Name | 4-chloro-2-methyl-5-phenylthieno[2,3-d]pyrimidine;(2R)-2-methylpiperazine |
| PubChem CID | 158753076 |
| Molecular Formula | C18H21ClN4S |
| Molecular Weight | 360.91 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | 4-chloro-2-methyl-5-phenylthieno[2,3-d]pyrimidine;(2R)-2-methylpiperazine |
| SMILES | C[C@@H]1CNCCN1.Cc1nc(Cl)c2c(-c3ccccc3)csc2n1 |
| InChI | InChI=1S/C13H9ClN2S.C5H12N2/c1-8-15-12(14)11-10(7-17-13(11)16-8)9-5-3-2-4-6-9;1-5-4-6-2-3-7-5/h2-7H,1H3;5-7H,2-4H2,1H3/t;5-/m.1/s1 |
| InChIKey | INSLYSNVKJHDCF-QDXATWJZSA-N |
| XLogP | 3.89 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.91 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-chloro-2-methyl-5-phenylthieno[2,3-d]pyrimidine;(2R)-2-methylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2-methyl-5-phenylthieno[2,3-d]pyrimidine;(2R)-2-methylpiperazine?
The IUPAC name of 4-chloro-2-methyl-5-phenylthieno[2,3-d]pyrimidine;(2R)-2-methylpiperazine (CID 158753076) is 4-chloro-2-methyl-5-phenylthieno[2,3-d]pyrimidine;(2R)-2-methylpiperazine.
What is the SMILES notation for 4-chloro-2-methyl-5-phenylthieno[2,3-d]pyrimidine;(2R)-2-methylpiperazine?
The canonical SMILES for 4-chloro-2-methyl-5-phenylthieno[2,3-d]pyrimidine;(2R)-2-methylpiperazine is C[C@@H]1CNCCN1.Cc1nc(Cl)c2c(-c3ccccc3)csc2n1.
What is the InChIKey of 4-chloro-2-methyl-5-phenylthieno[2,3-d]pyrimidine;(2R)-2-methylpiperazine?
The InChIKey is INSLYSNVKJHDCF-QDXATWJZSA-N. The full InChI is InChI=1S/C13H9ClN2S.C5H12N2/c1-8-15-12(14)11-10(7-17-13(11)16-8)9-5-3-2-4-6-9;1-5-4-6-2-3-7-5/h2-7H,1H3;5-7H,2-4H2,1H3/t;5-/m.1/s1.
What are the key properties of 4-chloro-2-methyl-5-phenylthieno[2,3-d]pyrimidine;(2R)-2-methylpiperazine?
4-chloro-2-methyl-5-phenylthieno[2,3-d]pyrimidine;(2R)-2-methylpiperazine has a molecular weight of 360.91 g/mol, XLogP of 3.89, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2-methyl-5-phenylthieno[2,3-d]pyrimidine;(2R)-2-methylpiperazine is sourced from PubChem (CID 158753076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).