C16H14ClN3S — CID 95506820
4-chloro-5-phenyl-2-pyrrolidin-1-ylthieno[2,3-d]pyrimidine (PubChem CID 95506820) has the molecular formula C16H14ClN3S and a molecular weight of 315.83 g/mol. Its IUPAC name is 4-chloro-5-phenyl-2-pyrrolidin-1-ylthieno[2,3-d]pyrimidine.
| Compound Name | 4-chloro-5-phenyl-2-pyrrolidin-1-ylthieno[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 95506820 |
| Molecular Formula | C16H14ClN3S |
| Molecular Weight | 315.83 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | 4-chloro-5-phenyl-2-pyrrolidin-1-ylthieno[2,3-d]pyrimidine |
| SMILES | Clc1nc(N2CCCC2)nc2scc(-c3ccccc3)c12 |
| InChI | InChI=1S/C16H14ClN3S/c17-14-13-12(11-6-2-1-3-7-11)10-21-15(13)19-16(18-14)20-8-4-5-9-20/h1-3,6-7,10H,4-5,8-9H2 |
| InChIKey | KMUIGJLBAZSRAY-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.83 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |