C26H19ClN2O5 — CID 158753406
5-chloro-3-(1,3-dioxo-4H-isoquinolin-2-yl)-1-[(3-methoxyphenyl)methyl]indole-2-carboxylic acid (PubChem CID 158753406) has the molecular formula C26H19ClN2O5 and a molecular weight of 474.90 g/mol. Its IUPAC name is 5-chloro-3-(1,3-dioxo-4H-isoquinolin-2-yl)-1-[(3-methoxyphenyl)methyl]indole-2-carboxylic acid.
| Compound Name | 5-chloro-3-(1,3-dioxo-4H-isoquinolin-2-yl)-1-[(3-methoxyphenyl)methyl]indole-2-carboxylic acid |
|---|---|
| PubChem CID | 158753406 |
| Molecular Formula | C26H19ClN2O5 |
| Molecular Weight | 474.90 g/mol |
| Exact Mass | 474.10 |
| IUPAC Name | 5-chloro-3-(1,3-dioxo-4H-isoquinolin-2-yl)-1-[(3-methoxyphenyl)methyl]indole-2-carboxylic acid |
| SMILES | COc1cccc(Cn2c(C(=O)O)c(N3C(=O)Cc4ccccc4C3=O)c3cc(Cl)ccc32)c1 |
| InChI | InChI=1S/C26H19ClN2O5/c1-34-18-7-4-5-15(11-18)14-28-21-10-9-17(27)13-20(21)23(24(28)26(32)33)29-22(30)12-16-6-2-3-8-19(16)25(29)31/h2-11,13H,12,14H2,1H3,(H,32,33) |
| InChIKey | INTLHMUPAYWCNJ-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 88.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.90 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|